About 3-phosphonohexanoate
3-phosphonohexanoate (PubChem CID 23202234) has the molecular formula C6H12O5P-
and a molecular weight of 195.13 g/mol. Its IUPAC name is 3-phosphonohexanoate.
Molecular Properties
| Compound Name | 3-phosphonohexanoate |
| PubChem CID | 23202234 |
| Molecular Formula | C6H12O5P- |
| Molecular Weight | 195.13 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 3-phosphonohexanoate |
| SMILES | CCCC(CC(=O)[O-])P(=O)(O)O |
| InChI | InChI=1S/C6H13O5P/c1-2-3-5(4-6(7)8)12(9,10)11/h5H,2-4H2,1H3,(H,7,8)(H2,9,10,11)/p-1 |
| InChIKey | IKIVDTMQAQLGHS-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.13 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-phosphonohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phosphonohexanoate?
The IUPAC name of 3-phosphonohexanoate (CID 23202234) is 3-phosphonohexanoate.
What is the SMILES notation for 3-phosphonohexanoate?
The canonical SMILES for 3-phosphonohexanoate is CCCC(CC(=O)[O-])P(=O)(O)O.
What is the InChIKey of 3-phosphonohexanoate?
The InChIKey is IKIVDTMQAQLGHS-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H13O5P/c1-2-3-5(4-6(7)8)12(9,10)11/h5H,2-4H2,1H3,(H,7,8)(H2,9,10,11)/p-1.
What are the key properties of 3-phosphonohexanoate?
3-phosphonohexanoate has a molecular weight of 195.13 g/mol, XLogP of -0.53, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phosphonohexanoate is sourced from PubChem (CID 23202234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).