C4H5O7PZn — CID 161140097
zinc 2-phosphonobutanedioate (PubChem CID 161140097) has the molecular formula C4H5O7PZn and a molecular weight of 261.44 g/mol. Its IUPAC name is zinc 2-phosphonobutanedioate.
| Compound Name | zinc 2-phosphonobutanedioate |
|---|---|
| PubChem CID | 161140097 |
| Molecular Formula | C4H5O7PZn |
| Molecular Weight | 261.44 g/mol |
| Exact Mass | 259.91 |
| IUPAC Name | zinc 2-phosphonobutanedioate |
| SMILES | O=C([O-])CC(C(=O)[O-])P(=O)(O)O.[Zn+2] |
| InChI | InChI=1S/C4H7O7P.Zn/c5-3(6)1-2(4(7)8)12(9,10)11;/h2H,1H2,(H,5,6)(H,7,8)(H2,9,10,11);/q;+2/p-2 |
| InChIKey | UNIDJTUVSGUIDM-UHFFFAOYSA-L |
| XLogP | -3.58 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.44 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|