About disodium;2-dibutylphosphorylbutanedioate
disodium;2-dibutylphosphorylbutanedioate (PubChem CID 142759821) has the molecular formula C12H21Na2O5P
and a molecular weight of 322.25 g/mol. Its IUPAC name is disodium;2-dibutylphosphorylbutanedioate.
Molecular Properties
| Compound Name | disodium;2-dibutylphosphorylbutanedioate |
| PubChem CID | 142759821 |
| Molecular Formula | C12H21Na2O5P |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | disodium;2-dibutylphosphorylbutanedioate |
| SMILES | CCCCP(=O)(CCCC)C(CC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C12H23O5P.2Na/c1-3-5-7-18(17,8-6-4-2)10(12(15)16)9-11(13)14;;/h10H,3-9H2,1-2H3,(H,13,14)(H,15,16);;/q;2*+1/p-2 |
| InChIKey | QXKWXWGCESZBOR-UHFFFAOYSA-L |
| XLogP | -5.78 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | -5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-dibutylphosphorylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-dibutylphosphorylbutanedioate?
The IUPAC name of disodium;2-dibutylphosphorylbutanedioate (CID 142759821) is disodium;2-dibutylphosphorylbutanedioate.
What is the SMILES notation for disodium;2-dibutylphosphorylbutanedioate?
The canonical SMILES for disodium;2-dibutylphosphorylbutanedioate is CCCCP(=O)(CCCC)C(CC(=O)[O-])C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;2-dibutylphosphorylbutanedioate?
The InChIKey is QXKWXWGCESZBOR-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H23O5P.2Na/c1-3-5-7-18(17,8-6-4-2)10(12(15)16)9-11(13)14;;/h10H,3-9H2,1-2H3,(H,13,14)(H,15,16);;/q;2*+1/p-2.
What are the key properties of disodium;2-dibutylphosphorylbutanedioate?
disodium;2-dibutylphosphorylbutanedioate has a molecular weight of 322.25 g/mol, XLogP of -5.78, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-dibutylphosphorylbutanedioate is sourced from PubChem (CID 142759821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).