C7H9Na4O10P — CID 141455470
tetrasodium;butane-1,2,4-tricarboxylate;dihydrogen phosphate (PubChem CID 141455470) has the molecular formula C7H9Na4O10P and a molecular weight of 376.07 g/mol. Its IUPAC name is tetrasodium;butane-1,2,4-tricarboxylate;dihydrogen phosphate.
| Compound Name | tetrasodium;butane-1,2,4-tricarboxylate;dihydrogen phosphate |
|---|---|
| PubChem CID | 141455470 |
| Molecular Formula | C7H9Na4O10P |
| Molecular Weight | 376.07 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | tetrasodium;butane-1,2,4-tricarboxylate;dihydrogen phosphate |
| SMILES | O=C([O-])CCC(CC(=O)[O-])C(=O)[O-].O=P([O-])(O)O.[Na+].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C7H10O6.4Na.H3O4P/c8-5(9)2-1-4(7(12)13)3-6(10)11;;;;;1-5(2,3)4/h4H,1-3H2,(H,8,9)(H,10,11)(H,12,13);;;;;(H3,1,2,3,4)/q;4*+1;/p-4 |
| InChIKey | ZVDDFGDYORKPLL-UHFFFAOYSA-J |
| XLogP | -17.52 |
| TPSA | 200.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.07 |
| LogP ≤ 5 | -17.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|