C4H6Na3O8P — CID 160603820
trisodium;butanedioate;dihydrogen phosphate (PubChem CID 160603820) has the molecular formula C4H6Na3O8P and a molecular weight of 282.03 g/mol. Its IUPAC name is trisodium;butanedioate;dihydrogen phosphate.
| Compound Name | trisodium;butanedioate;dihydrogen phosphate |
|---|---|
| PubChem CID | 160603820 |
| Molecular Formula | C4H6Na3O8P |
| Molecular Weight | 282.03 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | trisodium;butanedioate;dihydrogen phosphate |
| SMILES | O=C([O-])CCC(=O)[O-].O=P([O-])(O)O.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C4H6O4.3Na.H3O4P/c5-3(6)1-2-4(7)8;;;;1-5(2,3)4/h1-2H2,(H,5,6)(H,7,8);;;;(H3,1,2,3,4)/q;3*+1;/p-3 |
| InChIKey | REPUDHQXHLENSD-UHFFFAOYSA-K |
| XLogP | -13.28 |
| TPSA | 160.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.03 |
| LogP ≤ 5 | -13.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|