About bis(butanedioate);osmium(4+)
bis(butanedioate);osmium(4+) (PubChem CID 159559487) has the molecular formula C8H8O8Os
and a molecular weight of 422.37 g/mol. Its IUPAC name is bis(butanedioate);osmium(4+).
Molecular Properties
| Compound Name | bis(butanedioate);osmium(4+) |
| PubChem CID | 159559487 |
| Molecular Formula | C8H8O8Os |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | bis(butanedioate);osmium(4+) |
| SMILES | O=C([O-])CCC(=O)[O-].O=C([O-])CCC(=O)[O-].[Os+4] |
| InChI | InChI=1S/2C4H6O4.Os/c2*5-3(6)1-2-4(7)8;/h2*1-2H2,(H,5,6)(H,7,8);/q;;+4/p-4 |
| InChIKey | MGKOMBMBNQFZLY-UHFFFAOYSA-J |
| XLogP | -5.47 |
| TPSA | 160.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | -5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze bis(butanedioate);osmium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(butanedioate);osmium(4+)?
The IUPAC name of bis(butanedioate);osmium(4+) (CID 159559487) is bis(butanedioate);osmium(4+).
What is the SMILES notation for bis(butanedioate);osmium(4+)?
The canonical SMILES for bis(butanedioate);osmium(4+) is O=C([O-])CCC(=O)[O-].O=C([O-])CCC(=O)[O-].[Os+4].
What is the InChIKey of bis(butanedioate);osmium(4+)?
The InChIKey is MGKOMBMBNQFZLY-UHFFFAOYSA-J. The full InChI is InChI=1S/2C4H6O4.Os/c2*5-3(6)1-2-4(7)8;/h2*1-2H2,(H,5,6)(H,7,8);/q;;+4/p-4.
What are the key properties of bis(butanedioate);osmium(4+)?
bis(butanedioate);osmium(4+) has a molecular weight of 422.37 g/mol, XLogP of -5.47, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(butanedioate);osmium(4+) is sourced from PubChem (CID 159559487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).