About 4-oxoheptanedioate
4-oxoheptanedioate (PubChem CID 6995280) has the molecular formula C7H8O5-2
and a molecular weight of 172.14 g/mol. Its IUPAC name is 4-oxoheptanedioate.
Molecular Properties
| Compound Name | 4-oxoheptanedioate |
| PubChem CID | 6995280 |
| Molecular Formula | C7H8O5-2 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 4-oxoheptanedioate |
| SMILES | O=C([O-])CCC(=O)CCC(=O)[O-] |
| InChI | InChI=1S/C7H10O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H2,(H,9,10)(H,11,12)/p-2 |
| InChIKey | UDDSEESQRGPVIL-UHFFFAOYSA-L |
| XLogP | -2.38 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-oxoheptanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxoheptanedioate?
The IUPAC name of 4-oxoheptanedioate (CID 6995280) is 4-oxoheptanedioate.
What is the SMILES notation for 4-oxoheptanedioate?
The canonical SMILES for 4-oxoheptanedioate is O=C([O-])CCC(=O)CCC(=O)[O-].
What is the InChIKey of 4-oxoheptanedioate?
The InChIKey is UDDSEESQRGPVIL-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H10O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H2,(H,9,10)(H,11,12)/p-2.
What are the key properties of 4-oxoheptanedioate?
4-oxoheptanedioate has a molecular weight of 172.14 g/mol, XLogP of -2.38, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxoheptanedioate is sourced from PubChem (CID 6995280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).