About 3-bromopropanoate
3-bromopropanoate (PubChem CID 6993466) has the molecular formula C3H4BrO2-
and a molecular weight of 151.97 g/mol. Its IUPAC name is 3-bromopropanoate.
Molecular Properties
| Compound Name | 3-bromopropanoate |
| PubChem CID | 6993466 |
| Molecular Formula | C3H4BrO2- |
| Molecular Weight | 151.97 g/mol |
| Exact Mass | 150.94 |
| IUPAC Name | 3-bromopropanoate |
| SMILES | O=C([O-])CCBr |
| InChI | InChI=1S/C3H5BrO2/c4-2-1-3(5)6/h1-2H2,(H,5,6)/p-1 |
| InChIKey | DHXNZYCXMFBMHE-UHFFFAOYSA-M |
| XLogP | -0.48 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.97 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopropanoate?
The IUPAC name of 3-bromopropanoate (CID 6993466) is 3-bromopropanoate.
What is the SMILES notation for 3-bromopropanoate?
The canonical SMILES for 3-bromopropanoate is O=C([O-])CCBr.
What is the InChIKey of 3-bromopropanoate?
The InChIKey is DHXNZYCXMFBMHE-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H5BrO2/c4-2-1-3(5)6/h1-2H2,(H,5,6)/p-1.
What are the key properties of 3-bromopropanoate?
3-bromopropanoate has a molecular weight of 151.97 g/mol, XLogP of -0.48, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopropanoate is sourced from PubChem (CID 6993466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).