About lithium 4-bromobutanoate
lithium 4-bromobutanoate (PubChem CID 23701055) has the molecular formula C4H6BrLiO2
and a molecular weight of 172.93 g/mol. Its IUPAC name is lithium 4-bromobutanoate.
Molecular Properties
| Compound Name | lithium 4-bromobutanoate |
| PubChem CID | 23701055 |
| Molecular Formula | C4H6BrLiO2 |
| Molecular Weight | 172.93 g/mol |
| Exact Mass | 171.97 |
| IUPAC Name | lithium 4-bromobutanoate |
| SMILES | O=C([O-])CCCBr.[Li+] |
| InChI | InChI=1S/C4H7BrO2.Li/c5-3-1-2-4(6)7;/h1-3H2,(H,6,7);/q;+1/p-1 |
| InChIKey | HBKQWVYPYJFCCC-UHFFFAOYSA-M |
| XLogP | -3.08 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.93 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze lithium 4-bromobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 4-bromobutanoate?
The IUPAC name of lithium 4-bromobutanoate (CID 23701055) is lithium 4-bromobutanoate.
What is the SMILES notation for lithium 4-bromobutanoate?
The canonical SMILES for lithium 4-bromobutanoate is O=C([O-])CCCBr.[Li+].
What is the InChIKey of lithium 4-bromobutanoate?
The InChIKey is HBKQWVYPYJFCCC-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H7BrO2.Li/c5-3-1-2-4(6)7;/h1-3H2,(H,6,7);/q;+1/p-1.
What are the key properties of lithium 4-bromobutanoate?
lithium 4-bromobutanoate has a molecular weight of 172.93 g/mol, XLogP of -3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 4-bromobutanoate is sourced from PubChem (CID 23701055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).