About sodium 2-bromoacetate
sodium 2-bromoacetate (PubChem CID 23675628) has the molecular formula C2H2BrNaO2
and a molecular weight of 160.93 g/mol. Its IUPAC name is sodium 2-bromoacetate.
Molecular Properties
| Compound Name | sodium 2-bromoacetate |
| PubChem CID | 23675628 |
| Molecular Formula | C2H2BrNaO2 |
| Molecular Weight | 160.93 g/mol |
| Exact Mass | 159.91 |
| IUPAC Name | sodium 2-bromoacetate |
| SMILES | O=C([O-])CBr.[Na+] |
| InChI | InChI=1S/C2H3BrO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| InChIKey | SESSOVUNEZQNBV-UHFFFAOYSA-M |
| XLogP | -3.86 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.93 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-bromoacetate?
The IUPAC name of sodium 2-bromoacetate (CID 23675628) is sodium 2-bromoacetate.
What is the SMILES notation for sodium 2-bromoacetate?
The canonical SMILES for sodium 2-bromoacetate is O=C([O-])CBr.[Na+].
What is the InChIKey of sodium 2-bromoacetate?
The InChIKey is SESSOVUNEZQNBV-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H3BrO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1.
What are the key properties of sodium 2-bromoacetate?
sodium 2-bromoacetate has a molecular weight of 160.93 g/mol, XLogP of -3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-bromoacetate is sourced from PubChem (CID 23675628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).