C5H7NNa2O5 — CID 15217912
disodium;2-[carboxylatomethyl(hydroxymethyl)amino]acetate (PubChem CID 15217912) has the molecular formula C5H7NNa2O5 and a molecular weight of 207.09 g/mol. Its IUPAC name is disodium;2-[carboxylatomethyl(hydroxymethyl)amino]acetate.
| Compound Name | disodium;2-[carboxylatomethyl(hydroxymethyl)amino]acetate |
|---|---|
| PubChem CID | 15217912 |
| Molecular Formula | C5H7NNa2O5 |
| Molecular Weight | 207.09 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | disodium;2-[carboxylatomethyl(hydroxymethyl)amino]acetate |
| SMILES | O=C([O-])CN(CO)CC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C5H9NO5.2Na/c7-3-6(1-4(8)9)2-5(10)11;;/h7H,1-3H2,(H,8,9)(H,10,11);;/q;2*+1/p-2 |
| InChIKey | SMDXBNCTIGEQFT-UHFFFAOYSA-L |
| XLogP | -10.25 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.09 |
| LogP ≤ 5 | -10.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|