C6H33NNa2O17 — CID 173463557
disodium;2-[carboxylatomethyl(2-hydroxyethyl)amino]acetate;dodecahydrate (PubChem CID 173463557) has the molecular formula C6H33NNa2O17 and a molecular weight of 437.30 g/mol. Its IUPAC name is disodium;2-[carboxylatomethyl(2-hydroxyethyl)amino]acetate;dodecahydrate.
| Compound Name | disodium;2-[carboxylatomethyl(2-hydroxyethyl)amino]acetate;dodecahydrate |
|---|---|
| PubChem CID | 173463557 |
| Molecular Formula | C6H33NNa2O17 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | disodium;2-[carboxylatomethyl(2-hydroxyethyl)amino]acetate;dodecahydrate |
| SMILES | O.O.O.O.O.O.O.O.O.O.O.O.O=C([O-])CN(CCO)CC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C6H11NO5.2Na.12H2O/c8-2-1-7(3-5(9)10)4-6(11)12;;;;;;;;;;;;;;/h8H,1-4H2,(H,9,10)(H,11,12);;;12*1H2/q;2*+1;;;;;;;;;;;;/p-2 |
| InChIKey | TVDYNFYVMCLWOT-UHFFFAOYSA-L |
| XLogP | -20.11 |
| TPSA | 481.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | -20.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |