C6H12KNO4 — CID 156705178
potassium 2-[bis(2-hydroxyethyl)amino]acetate (PubChem CID 156705178) has the molecular formula C6H12KNO4 and a molecular weight of 201.26 g/mol. Its IUPAC name is potassium 2-[bis(2-hydroxyethyl)amino]acetate.
| Compound Name | potassium 2-[bis(2-hydroxyethyl)amino]acetate |
|---|---|
| PubChem CID | 156705178 |
| Molecular Formula | C6H12KNO4 |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | potassium 2-[bis(2-hydroxyethyl)amino]acetate |
| SMILES | O=C([O-])CN(CCO)CCO.[K+] |
| InChI | InChI=1S/C6H13NO4.K/c8-3-1-7(2-4-9)5-6(10)11;/h8-9H,1-5H2,(H,10,11);/q;+1/p-1 |
| InChIKey | JAIPPUROKQKCSY-UHFFFAOYSA-M |
| XLogP | -5.97 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | -5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |