C8H14N2Na2O5 — CID 6454342
disodium;2-[2-[carboxylatomethyl(2-hydroxyethyl)amino]ethylamino]acetate (PubChem CID 6454342) has the molecular formula C8H14N2Na2O5 and a molecular weight of 264.19 g/mol. Its IUPAC name is disodium;2-[2-[carboxylatomethyl(2-hydroxyethyl)amino]ethylamino]acetate.
| Compound Name | disodium;2-[2-[carboxylatomethyl(2-hydroxyethyl)amino]ethylamino]acetate |
|---|---|
| PubChem CID | 6454342 |
| Molecular Formula | C8H14N2Na2O5 |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | disodium;2-[2-[carboxylatomethyl(2-hydroxyethyl)amino]ethylamino]acetate |
| SMILES | O=C([O-])CNCCN(CCO)CC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H16N2O5.2Na/c11-4-3-10(6-8(14)15)2-1-9-5-7(12)13;;/h9,11H,1-6H2,(H,12,13)(H,14,15);;/q;2*+1/p-2 |
| InChIKey | XCCCVBYCQIOWMA-UHFFFAOYSA-L |
| XLogP | -10.62 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | -10.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|