C8H15N2NaO4 — CID 158747467
sodium 2-[2-acetamidoethyl(2-hydroxyethyl)amino]acetate (PubChem CID 158747467) has the molecular formula C8H15N2NaO4 and a molecular weight of 226.21 g/mol. Its IUPAC name is sodium 2-[2-acetamidoethyl(2-hydroxyethyl)amino]acetate.
| Compound Name | sodium 2-[2-acetamidoethyl(2-hydroxyethyl)amino]acetate |
|---|---|
| PubChem CID | 158747467 |
| Molecular Formula | C8H15N2NaO4 |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | sodium 2-[2-acetamidoethyl(2-hydroxyethyl)amino]acetate |
| SMILES | CC(=O)NCCN(CCO)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H16N2O4.Na/c1-7(12)9-2-3-10(4-5-11)6-8(13)14;/h11H,2-6H2,1H3,(H,9,12)(H,13,14);/q;+1/p-1 |
| InChIKey | VISINIGRBYPYDW-UHFFFAOYSA-M |
| XLogP | -5.83 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | -5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |