C9H17N3O4 — CID 142305680
3-[2-acetamidoethyl(2-hydroxyethyl)amino]-N-oxopropanamide (PubChem CID 142305680) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is 3-[2-acetamidoethyl(2-hydroxyethyl)amino]-N-oxopropanamide.
| Compound Name | 3-[2-acetamidoethyl(2-hydroxyethyl)amino]-N-oxopropanamide |
|---|---|
| PubChem CID | 142305680 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 3-[2-acetamidoethyl(2-hydroxyethyl)amino]-N-oxopropanamide |
| SMILES | CC(=O)NCCN(CCO)CCC(=O)N=O |
| InChI | InChI=1S/C9H17N3O4/c1-8(14)10-3-5-12(6-7-13)4-2-9(15)11-16/h13H,2-7H2,1H3,(H,10,14) |
| InChIKey | ZPCBRFRRRVJBEO-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |