C7H13N2O4- — CID 20708503
2-[2-acetamidoethyl(hydroxymethyl)amino]acetate (PubChem CID 20708503) has the molecular formula C7H13N2O4- and a molecular weight of 189.19 g/mol. Its IUPAC name is 2-[2-acetamidoethyl(hydroxymethyl)amino]acetate.
| Compound Name | 2-[2-acetamidoethyl(hydroxymethyl)amino]acetate |
|---|---|
| PubChem CID | 20708503 |
| Molecular Formula | C7H13N2O4- |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-[2-acetamidoethyl(hydroxymethyl)amino]acetate |
| SMILES | CC(=O)NCCN(CO)CC(=O)[O-] |
| InChI | InChI=1S/C7H14N2O4/c1-6(11)8-2-3-9(5-10)4-7(12)13/h10H,2-5H2,1H3,(H,8,11)(H,12,13)/p-1 |
| InChIKey | IMPXFPGPHJFRGW-UHFFFAOYSA-M |
| XLogP | -2.88 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|