2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid

C9H16N2O7 — CID 91527468

IUPAC2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid
SMILESCC(=O)NCCN(CC(=O)O)CC(=O)O.O=CO
InChIInChI=1S/C8H14N2O5.CH2O2/c1-6(11)9-2-3-10(4-7(12)13)5-8(14)15;2-1-3/h2-5H2,1H3,(H,9,11)(H,12,13)(H,14,15);1H,(H,2,3)
InChIKeyOIOJMDBDBBOALZ-UHFFFAOYSA-N
MW264.23 g/mol
LogP-1.71
Rot. Bonds7

About 2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid

2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid (PubChem CID 91527468) has the molecular formula C9H16N2O7 and a molecular weight of 264.23 g/mol. Its IUPAC name is 2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid.

Molecular Properties

Compound Name2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid
PubChem CID91527468
Molecular FormulaC9H16N2O7
Molecular Weight264.23 g/mol
Exact Mass264.10
IUPAC Name2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid
SMILESCC(=O)NCCN(CC(=O)O)CC(=O)O.O=CO
InChIInChI=1S/C8H14N2O5.CH2O2/c1-6(11)9-2-3-10(4-7(12)13)5-8(14)15;2-1-3/h2-5H2,1H3,(H,9,11)(H,12,13)(H,14,15);1H,(H,2,3)
InChIKeyOIOJMDBDBBOALZ-UHFFFAOYSA-N
XLogP-1.71
TPSA144.24 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.23
LogP ≤ 5-1.71
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid?
The IUPAC name of 2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid (CID 91527468) is 2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid.
What is the SMILES notation for 2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid?
The canonical SMILES for 2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid is CC(=O)NCCN(CC(=O)O)CC(=O)O.O=CO.
What is the InChIKey of 2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid?
The InChIKey is OIOJMDBDBBOALZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O5.CH2O2/c1-6(11)9-2-3-10(4-7(12)13)5-8(14)15;2-1-3/h2-5H2,1H3,(H,9,11)(H,12,13)(H,14,15);1H,(H,2,3).
What are the key properties of 2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid?
2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid has a molecular weight of 264.23 g/mol, XLogP of -1.71, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-acetamidoethyl(carboxymethyl)amino]acetic acid;formic acid is sourced from PubChem (CID 91527468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).