C34H63N7O16 — CID 22943944
2-[bis[2-[[2-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-(carboxymethyl)amino]ethyl]amino]acetic acid (PubChem CID 22943944) has the molecular formula C34H63N7O16 and a molecular weight of 825.91 g/mol. Its IUPAC name is 2-[bis[2-[[2-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-(carboxymethyl)amino]ethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-[[2-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-(carboxymethyl)amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 22943944 |
| Molecular Formula | C34H63N7O16 |
| Molecular Weight | 825.91 g/mol |
| Exact Mass | 825.43 |
| IUPAC Name | 2-[bis[2-[[2-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-(carboxymethyl)amino]ethyl]amino]acetic acid |
| SMILES | CC(=O)NCCOCCOCCOCCNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)NCCOCCOCCOCCNC(C)=O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C34H63N7O16/c1-28(42)35-3-11-52-15-19-56-21-17-54-13-5-37-30(44)23-40(26-33(48)49)9-7-39(25-32(46)47)8-10-41(27-34(50)51)24-31(45)38-6-14-55-18-22-57-20-16-53-12-4-36-29(2)43/h3-27H2,1-2H3,(H,35,42)(H,36,43)(H,37,44)(H,38,45)(H,46,47)(H,48,49)(H,50,51) |
| InChIKey | OBHXCWKQBFEFRX-UHFFFAOYSA-N |
| XLogP | -4.25 |
| TPSA | 293.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.91 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|