C15H30N4O4 — CID 59098642
2-[bis(2-acetamidoethyl)amino]-N-(2-propoxyethyl)acetamide (PubChem CID 59098642) has the molecular formula C15H30N4O4 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-[bis(2-acetamidoethyl)amino]-N-(2-propoxyethyl)acetamide.
| Compound Name | 2-[bis(2-acetamidoethyl)amino]-N-(2-propoxyethyl)acetamide |
|---|---|
| PubChem CID | 59098642 |
| Molecular Formula | C15H30N4O4 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 2-[bis(2-acetamidoethyl)amino]-N-(2-propoxyethyl)acetamide |
| SMILES | CCCOCCNC(=O)CN(CCNC(C)=O)CCNC(C)=O |
| InChI | InChI=1S/C15H30N4O4/c1-4-10-23-11-7-18-15(22)12-19(8-5-16-13(2)20)9-6-17-14(3)21/h4-12H2,1-3H3,(H,16,20)(H,17,21)(H,18,22) |
| InChIKey | ZVJFHCVNDDUWRJ-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|