C16H29N3O8 — CID 23524479
2-[2-[bis(carboxymethyl)amino]ethyl-[2-(2-butoxyethylamino)-2-oxoethyl]amino]acetic acid (PubChem CID 23524479) has the molecular formula C16H29N3O8 and a molecular weight of 391.42 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-(2-butoxyethylamino)-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-(2-butoxyethylamino)-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 23524479 |
| Molecular Formula | C16H29N3O8 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-(2-butoxyethylamino)-2-oxoethyl]amino]acetic acid |
| SMILES | CCCCOCCNC(=O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C16H29N3O8/c1-2-3-7-27-8-4-17-13(20)9-18(10-14(21)22)5-6-19(11-15(23)24)12-16(25)26/h2-12H2,1H3,(H,17,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | KLZORXRCOPTKJH-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 156.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|