C12H25ClN2O4 — CID 119912838
2-[[2-(2-butoxyethylamino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride (PubChem CID 119912838) has the molecular formula C12H25ClN2O4 and a molecular weight of 296.80 g/mol. Its IUPAC name is 2-[[2-(2-butoxyethylamino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride.
| Compound Name | 2-[[2-(2-butoxyethylamino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119912838 |
| Molecular Formula | C12H25ClN2O4 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-[[2-(2-butoxyethylamino)-2-oxoethyl]-methylamino]propanoic acid;hydrochloride |
| SMILES | CCCCOCCNC(=O)CN(C)C(C)C(=O)O.Cl |
| InChI | InChI=1S/C12H24N2O4.ClH/c1-4-5-7-18-8-6-13-11(15)9-14(3)10(2)12(16)17;/h10H,4-9H2,1-3H3,(H,13,15)(H,16,17);1H |
| InChIKey | KYALVBPZHBJCMH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|