C16H27N4O11P — CID 163948609
2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-(2-phosphorosooxyethylamino)ethyl]amino]ethyl]amino]acetic acid (PubChem CID 163948609) has the molecular formula C16H27N4O11P and a molecular weight of 482.38 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-(2-phosphorosooxyethylamino)ethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-(2-phosphorosooxyethylamino)ethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 163948609 |
| Molecular Formula | C16H27N4O11P |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-(2-phosphorosooxyethylamino)ethyl]amino]ethyl]amino]acetic acid |
| SMILES | O=POCCNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C16H27N4O11P/c21-12(17-1-6-31-32-30)7-19(9-14(24)25)4-2-18(8-13(22)23)3-5-20(10-15(26)27)11-16(28)29/h1-11H2,(H,17,21)(H,22,23)(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | RXIIBYZOBVVUEU-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 214.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|