C17H28N4O10 — CID 21305876
2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-(3-oxopropylamino)ethyl]amino]ethyl]amino]acetic acid (PubChem CID 21305876) has the molecular formula C17H28N4O10 and a molecular weight of 448.43 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-(3-oxopropylamino)ethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-(3-oxopropylamino)ethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 21305876 |
| Molecular Formula | C17H28N4O10 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-(3-oxopropylamino)ethyl]amino]ethyl]amino]acetic acid |
| SMILES | O=CCCNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C17H28N4O10/c22-7-1-2-18-13(23)8-20(10-15(26)27)5-3-19(9-14(24)25)4-6-21(11-16(28)29)12-17(30)31/h7H,1-6,8-12H2,(H,18,23)(H,24,25)(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | GIMSTIMIOXTWQL-UHFFFAOYSA-N |
| XLogP | -3.06 |
| TPSA | 205.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|