C26H53N5O14Si2 — CID 102089398
2-[bis[2-[carboxymethyl-[2-oxo-2-(3-trimethoxysilylpropylamino)ethyl]amino]ethyl]amino]acetic acid (PubChem CID 102089398) has the molecular formula C26H53N5O14Si2 and a molecular weight of 715.90 g/mol. Its IUPAC name is 2-[bis[2-[carboxymethyl-[2-oxo-2-(3-trimethoxysilylpropylamino)ethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-(3-trimethoxysilylpropylamino)ethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 102089398 |
| Molecular Formula | C26H53N5O14Si2 |
| Molecular Weight | 715.90 g/mol |
| Exact Mass | 715.31 |
| IUPAC Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-(3-trimethoxysilylpropylamino)ethyl]amino]ethyl]amino]acetic acid |
| SMILES | CO[Si](CCCNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)NCCC[Si](OC)(OC)OC)CC(=O)O)CC(=O)O)(OC)OC |
| InChI | InChI=1S/C26H53N5O14Si2/c1-40-46(41-2,42-3)15-7-9-27-22(32)17-30(20-25(36)37)13-11-29(19-24(34)35)12-14-31(21-26(38)39)18-23(33)28-10-8-16-47(43-4,44-5)45-6/h7-21H2,1-6H3,(H,27,32)(H,28,33)(H,34,35)(H,36,37)(H,38,39) |
| InChIKey | RZYPPVNTTLPUPI-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 235.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.90 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|