C20H35N5O10 — CID 90452505
2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-[2-(prop-1-en-2-yloxymethylamino)ethylamino]ethyl]amino]ethyl]amino]acetic acid (PubChem CID 90452505) has the molecular formula C20H35N5O10 and a molecular weight of 505.53 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-[2-(prop-1-en-2-yloxymethylamino)ethylamino]ethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-[2-(prop-1-en-2-yloxymethylamino)ethylamino]ethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 90452505 |
| Molecular Formula | C20H35N5O10 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-[2-(prop-1-en-2-yloxymethylamino)ethylamino]ethyl]amino]ethyl]amino]acetic acid |
| SMILES | C=C(C)OCNCCNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C20H35N5O10/c1-15(2)35-14-21-3-4-22-16(26)9-24(11-18(29)30)7-5-23(10-17(27)28)6-8-25(12-19(31)32)13-20(33)34/h21H,1,3-14H2,2H3,(H,22,26)(H,27,28)(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | ZWFVTDMHCVSVFZ-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 209.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|