About 2-[2-[bis(carboxymethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(2+)
2-[2-[bis(carboxymethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(2+) (PubChem CID 59081063) has the molecular formula C13H21FeN3O8+2
and a molecular weight of 403.17 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(2+).
Molecular Properties
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(2+) |
| PubChem CID | 59081063 |
| Molecular Formula | C13H21FeN3O8+2 |
| Molecular Weight | 403.17 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(2+) |
| SMILES | CC(=O)CNC(=O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.[Fe+2] |
| InChI | InChI=1S/C13H21N3O8.Fe/c1-9(17)4-14-10(18)5-15(6-11(19)20)2-3-16(7-12(21)22)8-13(23)24;/h2-8H2,1H3,(H,14,18)(H,19,20)(H,21,22)(H,23,24);/q;+2 |
| InChIKey | RIELAJIXFPEPRR-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 164.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.17 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[bis(carboxymethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[bis(carboxymethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(2+)?
The IUPAC name of 2-[2-[bis(carboxymethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(2+) (CID 59081063) is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(2+).
What is the SMILES notation for 2-[2-[bis(carboxymethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(2+)?
The canonical SMILES for 2-[2-[bis(carboxymethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(2+) is CC(=O)CNC(=O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.[Fe+2].
What is the InChIKey of 2-[2-[bis(carboxymethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(2+)?
The InChIKey is RIELAJIXFPEPRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O8.Fe/c1-9(17)4-14-10(18)5-15(6-11(19)20)2-3-16(7-12(21)22)8-13(23)24;/h2-8H2,1H3,(H,14,18)(H,19,20)(H,21,22)(H,23,24);/q;+2.
What are the key properties of 2-[2-[bis(carboxymethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(2+)?
2-[2-[bis(carboxymethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(2+) has a molecular weight of 403.17 g/mol, XLogP of -2.45, 13 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[bis(carboxymethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(2+) is sourced from PubChem (CID 59081063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).