C12H20FeN2NaO6+3 — CID 25052150
sodium;2-[2-[bis(2-oxopropyl)amino]ethyl-(carboxymethyl)amino]acetic acid;iron(2+) (PubChem CID 25052150) has the molecular formula C12H20FeN2NaO6+3 and a molecular weight of 367.14 g/mol. Its IUPAC name is sodium;2-[2-[bis(2-oxopropyl)amino]ethyl-(carboxymethyl)amino]acetic acid;iron(2+).
| Compound Name | sodium;2-[2-[bis(2-oxopropyl)amino]ethyl-(carboxymethyl)amino]acetic acid;iron(2+) |
|---|---|
| PubChem CID | 25052150 |
| Molecular Formula | C12H20FeN2NaO6+3 |
| Molecular Weight | 367.14 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | sodium;2-[2-[bis(2-oxopropyl)amino]ethyl-(carboxymethyl)amino]acetic acid;iron(2+) |
| SMILES | CC(=O)CN(CCN(CC(=O)O)CC(=O)O)CC(C)=O.[Fe+2].[Na+] |
| InChI | InChI=1S/C12H20N2O6.Fe.Na/c1-9(15)5-13(6-10(2)16)3-4-14(7-11(17)18)8-12(19)20;;/h3-8H2,1-2H3,(H,17,18)(H,19,20);;/q;+2;+1 |
| InChIKey | MSPBTHQQZLLBHW-UHFFFAOYSA-N |
| XLogP | -4.06 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.14 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|