C14H22FeN3O8+2 — CID 59081197
2-[2-[carboxymethyl-(2-methanidyloxy-2-oxoethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(3+) (PubChem CID 59081197) has the molecular formula C14H22FeN3O8+2 and a molecular weight of 416.19 g/mol. Its IUPAC name is 2-[2-[carboxymethyl-(2-methanidyloxy-2-oxoethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(3+).
| Compound Name | 2-[2-[carboxymethyl-(2-methanidyloxy-2-oxoethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(3+) |
|---|---|
| PubChem CID | 59081197 |
| Molecular Formula | C14H22FeN3O8+2 |
| Molecular Weight | 416.19 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 2-[2-[carboxymethyl-(2-methanidyloxy-2-oxoethyl)amino]ethyl-[2-oxo-2-(2-oxopropylamino)ethyl]amino]acetic acid;iron(3+) |
| SMILES | [CH2-]OC(=O)CN(CCN(CC(=O)O)CC(=O)NCC(C)=O)CC(=O)O.[Fe+3] |
| InChI | InChI=1S/C14H22N3O8.Fe/c1-10(18)5-15-11(19)6-16(7-12(20)21)3-4-17(8-13(22)23)9-14(24)25-2;/h2-9H2,1H3,(H,15,19)(H,20,21)(H,22,23);/q-1;+3 |
| InChIKey | YECNSTGAPUAKPV-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.19 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|