C21H42N6O5 — CID 58601893
(2S)-N-[2-[2-[[2-[bis(2-acetamidoethyl)amino]acetyl]amino]ethoxy]ethyl]-4-methyl-2-(methylamino)pentanamide (PubChem CID 58601893) has the molecular formula C21H42N6O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is (2S)-N-[2-[2-[[2-[bis(2-acetamidoethyl)amino]acetyl]amino]ethoxy]ethyl]-4-methyl-2-(methylamino)pentanamide.
| Compound Name | (2S)-N-[2-[2-[[2-[bis(2-acetamidoethyl)amino]acetyl]amino]ethoxy]ethyl]-4-methyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 58601893 |
| Molecular Formula | C21H42N6O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | (2S)-N-[2-[2-[[2-[bis(2-acetamidoethyl)amino]acetyl]amino]ethoxy]ethyl]-4-methyl-2-(methylamino)pentanamide |
| SMILES | CN[C@@H](CC(C)C)C(=O)NCCOCCNC(=O)CN(CCNC(C)=O)CCNC(C)=O |
| InChI | InChI=1S/C21H42N6O5/c1-16(2)14-19(22-5)21(31)26-9-13-32-12-8-25-20(30)15-27(10-6-23-17(3)28)11-7-24-18(4)29/h16,19,22H,6-15H2,1-5H3,(H,23,28)(H,24,29)(H,25,30)(H,26,31)/t19-/m0/s1 |
| InChIKey | HGYPENADEUSWOA-IBGZPJMESA-N |
| XLogP | -1.56 |
| TPSA | 140.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|