C8H14CuN2O6 — CID 155766345
2-[2-[bis(carboxymethyl)amino]ethylamino]acetic acid;copper (PubChem CID 155766345) has the molecular formula C8H14CuN2O6 and a molecular weight of 297.75 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethylamino]acetic acid;copper.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethylamino]acetic acid;copper |
|---|---|
| PubChem CID | 155766345 |
| Molecular Formula | C8H14CuN2O6 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethylamino]acetic acid;copper |
| SMILES | O=C(O)CNCCN(CC(=O)O)CC(=O)O.[Cu] |
| InChI | InChI=1S/C8H14N2O6.Cu/c11-6(12)3-9-1-2-10(4-7(13)14)5-8(15)16;/h9H,1-5H2,(H,11,12)(H,13,14)(H,15,16); |
| InChIKey | OVYZLVLKNSVUOX-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|