C14H25N3O7 — CID 174336280
2-[2-[carboxymethyl-[2-(carboxymethylamino)ethyl]amino]ethylamino]-5-oxohexanoic acid (PubChem CID 174336280) has the molecular formula C14H25N3O7 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-[2-[carboxymethyl-[2-(carboxymethylamino)ethyl]amino]ethylamino]-5-oxohexanoic acid.
| Compound Name | 2-[2-[carboxymethyl-[2-(carboxymethylamino)ethyl]amino]ethylamino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 174336280 |
| Molecular Formula | C14H25N3O7 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-[2-[carboxymethyl-[2-(carboxymethylamino)ethyl]amino]ethylamino]-5-oxohexanoic acid |
| SMILES | CC(=O)CCC(NCCN(CCNCC(=O)O)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H25N3O7/c1-10(18)2-3-11(14(23)24)16-5-7-17(9-13(21)22)6-4-15-8-12(19)20/h11,15-16H,2-9H2,1H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | QAQXRMRROJDINP-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 156.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|