C14H27N3O8 — CID 155315135
2-[(5-amino-5-carboxypentyl)amino]pentanedioic acid;2-(methylamino)acetic acid (PubChem CID 155315135) has the molecular formula C14H27N3O8 and a molecular weight of 365.38 g/mol. Its IUPAC name is 2-[(5-amino-5-carboxypentyl)amino]pentanedioic acid;2-(methylamino)acetic acid.
| Compound Name | 2-[(5-amino-5-carboxypentyl)amino]pentanedioic acid;2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 155315135 |
| Molecular Formula | C14H27N3O8 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 2-[(5-amino-5-carboxypentyl)amino]pentanedioic acid;2-(methylamino)acetic acid |
| SMILES | CNCC(=O)O.NC(CCCCNC(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H20N2O6.C3H7NO2/c12-7(10(16)17)3-1-2-6-13-8(11(18)19)4-5-9(14)15;1-4-2-3(5)6/h7-8,13H,1-6,12H2,(H,14,15)(H,16,17)(H,18,19);4H,2H2,1H3,(H,5,6) |
| InChIKey | LFXIVIMTAFNVDO-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 199.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|