C8H14FNO4 — CID 174597642
2-(3-fluoropropylamino)pentanedioic acid (PubChem CID 174597642) has the molecular formula C8H14FNO4 and a molecular weight of 207.20 g/mol. Its IUPAC name is 2-(3-fluoropropylamino)pentanedioic acid.
| Compound Name | 2-(3-fluoropropylamino)pentanedioic acid |
|---|---|
| PubChem CID | 174597642 |
| Molecular Formula | C8H14FNO4 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-(3-fluoropropylamino)pentanedioic acid |
| SMILES | O=C(O)CCC(NCCCF)C(=O)O |
| InChI | InChI=1S/C8H14FNO4/c9-4-1-5-10-6(8(13)14)2-3-7(11)12/h6,10H,1-5H2,(H,11,12)(H,13,14) |
| InChIKey | WECDOYIWYDTFMX-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|