C12H21NO6 — CID 160711240
2-(4-carboxyhexylamino)pentanedioic acid (PubChem CID 160711240) has the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-(4-carboxyhexylamino)pentanedioic acid.
| Compound Name | 2-(4-carboxyhexylamino)pentanedioic acid |
|---|---|
| PubChem CID | 160711240 |
| Molecular Formula | C12H21NO6 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-(4-carboxyhexylamino)pentanedioic acid |
| SMILES | CCC(CCCNC(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H21NO6/c1-2-8(11(16)17)4-3-7-13-9(12(18)19)5-6-10(14)15/h8-9,13H,2-7H2,1H3,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | RRWRGQLHCGOWEQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|