C11H19IN2O6 — CID 175804889
(2S)-2-[[(5S)-5-carboxy-5-(iodoamino)pentyl]amino]pentanedioic acid (PubChem CID 175804889) has the molecular formula C11H19IN2O6 and a molecular weight of 402.19 g/mol. Its IUPAC name is (2S)-2-[[(5S)-5-carboxy-5-(iodoamino)pentyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(5S)-5-carboxy-5-(iodoamino)pentyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 175804889 |
| Molecular Formula | C11H19IN2O6 |
| Molecular Weight | 402.19 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | (2S)-2-[[(5S)-5-carboxy-5-(iodoamino)pentyl]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NCCCC[C@H](NI)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H19IN2O6/c12-14-8(11(19)20)3-1-2-6-13-7(10(17)18)4-5-9(15)16/h7-8,13-14H,1-6H2,(H,15,16)(H,17,18)(H,19,20)/t7-,8-/m0/s1 |
| InChIKey | DAOGPBIIBLTQJC-YUMQZZPRSA-N |
| XLogP | 0.46 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|