C33H51N3O24 — CID 161469042
2-[3-(1,2-dicarboxyethylamino)propyl]butanedioic acid;2-[3-(dicarboxymethylamino)propyl]propanedioic acid;2-[3-(1,3-dicarboxypropylamino)propyl]pentanedioic acid (PubChem CID 161469042) has the molecular formula C33H51N3O24 and a molecular weight of 873.77 g/mol. Its IUPAC name is 2-[3-(1,2-dicarboxyethylamino)propyl]butanedioic acid;2-[3-(dicarboxymethylamino)propyl]propanedioic acid;2-[3-(1,3-dicarboxypropylamino)propyl]pentanedioic acid.
| Compound Name | 2-[3-(1,2-dicarboxyethylamino)propyl]butanedioic acid;2-[3-(dicarboxymethylamino)propyl]propanedioic acid;2-[3-(1,3-dicarboxypropylamino)propyl]pentanedioic acid |
|---|---|
| PubChem CID | 161469042 |
| Molecular Formula | C33H51N3O24 |
| Molecular Weight | 873.77 g/mol |
| Exact Mass | 873.29 |
| IUPAC Name | 2-[3-(1,2-dicarboxyethylamino)propyl]butanedioic acid;2-[3-(dicarboxymethylamino)propyl]propanedioic acid;2-[3-(1,3-dicarboxypropylamino)propyl]pentanedioic acid |
| SMILES | O=C(O)C(CCCNC(C(=O)O)C(=O)O)C(=O)O.O=C(O)CC(CCCNC(CC(=O)O)C(=O)O)C(=O)O.O=C(O)CCC(CCCNC(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H21NO8.C11H17NO8.C9H13NO8/c15-10(16)5-3-8(12(19)20)2-1-7-14-9(13(21)22)4-6-11(17)18;13-8(14)4-6(10(17)18)2-1-3-12-7(11(19)20)5-9(15)16;11-6(12)4(7(13)14)2-1-3-10-5(8(15)16)9(17)18/h8-9,14H,1-7H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22);6-7,12H,1-5H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);4-5,10H,1-3H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | WCVBUOAJBQELBP-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 483.69 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.77 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|