C30H48N6O24 — CID 162136670
2-[2-(1,2-dicarboxyethylamino)ethylamino]butanedioic acid;2-[2-(dicarboxymethylamino)ethylamino]propanedioic acid;2-[2-(1,3-dicarboxypropylamino)ethylamino]pentanedioic acid (PubChem CID 162136670) has the molecular formula C30H48N6O24 and a molecular weight of 876.73 g/mol. Its IUPAC name is 2-[2-(1,2-dicarboxyethylamino)ethylamino]butanedioic acid;2-[2-(dicarboxymethylamino)ethylamino]propanedioic acid;2-[2-(1,3-dicarboxypropylamino)ethylamino]pentanedioic acid.
| Compound Name | 2-[2-(1,2-dicarboxyethylamino)ethylamino]butanedioic acid;2-[2-(dicarboxymethylamino)ethylamino]propanedioic acid;2-[2-(1,3-dicarboxypropylamino)ethylamino]pentanedioic acid |
|---|---|
| PubChem CID | 162136670 |
| Molecular Formula | C30H48N6O24 |
| Molecular Weight | 876.73 g/mol |
| Exact Mass | 876.27 |
| IUPAC Name | 2-[2-(1,2-dicarboxyethylamino)ethylamino]butanedioic acid;2-[2-(dicarboxymethylamino)ethylamino]propanedioic acid;2-[2-(1,3-dicarboxypropylamino)ethylamino]pentanedioic acid |
| SMILES | O=C(O)C(NCCNC(C(=O)O)C(=O)O)C(=O)O.O=C(O)CC(NCCNC(CC(=O)O)C(=O)O)C(=O)O.O=C(O)CCC(NCCNC(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H20N2O8.C10H16N2O8.C8H12N2O8/c15-9(16)3-1-7(11(19)20)13-5-6-14-8(12(21)22)2-4-10(17)18;13-7(14)3-5(9(17)18)11-1-2-12-6(10(19)20)4-8(15)16;11-5(12)3(6(13)14)9-1-2-10-4(7(15)16)8(17)18/h7-8,13-14H,1-6H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22);5-6,11-12H,1-4H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);3-4,9-10H,1-2H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | ZJJNFPOIYXFVSL-UHFFFAOYSA-N |
| XLogP | -5.94 |
| TPSA | 519.78 Ų |
| H-Bond Donors | 18 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.73 |
| LogP ≤ 5 | -5.94 |
| H-Bond Donors ≤ 5 | 18 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|