C10H19N3O6 — CID 129095324
(2S)-2-[[(2S)-2-(2-aminoethylamino)-2-carboxyethyl]amino]pentanedioic acid (PubChem CID 129095324) has the molecular formula C10H19N3O6 and a molecular weight of 277.28 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(2-aminoethylamino)-2-carboxyethyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-(2-aminoethylamino)-2-carboxyethyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 129095324 |
| Molecular Formula | C10H19N3O6 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (2S)-2-[[(2S)-2-(2-aminoethylamino)-2-carboxyethyl]amino]pentanedioic acid |
| SMILES | NCCN[C@@H](CN[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H19N3O6/c11-3-4-12-7(10(18)19)5-13-6(9(16)17)1-2-8(14)15/h6-7,12-13H,1-5,11H2,(H,14,15)(H,16,17)(H,18,19)/t6-,7-/m0/s1 |
| InChIKey | AXPSLOVWCXOWCS-BQBZGAKWSA-N |
| XLogP | -2.10 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |