C14H28N4O8 — CID 163564559
2-[2-[2-[carboxymethyl-[2-(carboxymethylamino)ethyl]amino]ethyl-(2,2-dihydroxyethyl)amino]ethylamino]acetic acid (PubChem CID 163564559) has the molecular formula C14H28N4O8 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-[2-[2-[carboxymethyl-[2-(carboxymethylamino)ethyl]amino]ethyl-(2,2-dihydroxyethyl)amino]ethylamino]acetic acid.
| Compound Name | 2-[2-[2-[carboxymethyl-[2-(carboxymethylamino)ethyl]amino]ethyl-(2,2-dihydroxyethyl)amino]ethylamino]acetic acid |
|---|---|
| PubChem CID | 163564559 |
| Molecular Formula | C14H28N4O8 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 2-[2-[2-[carboxymethyl-[2-(carboxymethylamino)ethyl]amino]ethyl-(2,2-dihydroxyethyl)amino]ethylamino]acetic acid |
| SMILES | O=C(O)CNCCN(CCN(CCNCC(=O)O)CC(O)O)CC(=O)O |
| InChI | InChI=1S/C14H28N4O8/c19-11(20)7-15-1-3-17(9-13(23)24)5-6-18(10-14(25)26)4-2-16-8-12(21)22/h13,15-16,23-24H,1-10H2,(H,19,20)(H,21,22)(H,25,26) |
| InChIKey | FUBYIZSAWZWUSJ-UHFFFAOYSA-N |
| XLogP | -3.67 |
| TPSA | 182.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|