C18H36N4O8 — CID 143929196
2-[2-[carboxymethyl(propyl)amino]ethylamino]acetic acid (PubChem CID 143929196) has the molecular formula C18H36N4O8 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[2-[carboxymethyl(propyl)amino]ethylamino]acetic acid.
| Compound Name | 2-[2-[carboxymethyl(propyl)amino]ethylamino]acetic acid |
|---|---|
| PubChem CID | 143929196 |
| Molecular Formula | C18H36N4O8 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 2-[2-[carboxymethyl(propyl)amino]ethylamino]acetic acid |
| SMILES | CCCN(CCNCC(=O)O)CC(=O)O.CCCN(CCNCC(=O)O)CC(=O)O |
| InChI | InChI=1S/2C9H18N2O4/c2*1-2-4-11(7-9(14)15)5-3-10-6-8(12)13/h2*10H,2-7H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | IRUTWJCEADRBRI-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 179.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|