C16H32N4O6 — CID 163915904
2-[2-[2-[tert-butyl-[2-(carboxymethylamino)ethyl]amino]ethyl-(carboxymethyl)amino]ethylamino]acetic acid (PubChem CID 163915904) has the molecular formula C16H32N4O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-[2-[2-[tert-butyl-[2-(carboxymethylamino)ethyl]amino]ethyl-(carboxymethyl)amino]ethylamino]acetic acid.
| Compound Name | 2-[2-[2-[tert-butyl-[2-(carboxymethylamino)ethyl]amino]ethyl-(carboxymethyl)amino]ethylamino]acetic acid |
|---|---|
| PubChem CID | 163915904 |
| Molecular Formula | C16H32N4O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2-[2-[2-[tert-butyl-[2-(carboxymethylamino)ethyl]amino]ethyl-(carboxymethyl)amino]ethylamino]acetic acid |
| SMILES | CC(C)(C)N(CCNCC(=O)O)CCN(CCNCC(=O)O)CC(=O)O |
| InChI | InChI=1S/C16H32N4O6/c1-16(2,3)20(7-5-18-11-14(23)24)9-8-19(12-15(25)26)6-4-17-10-13(21)22/h17-18H,4-12H2,1-3H3,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | QWFHBHXBXDDQCJ-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 142.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|