C19H37N5O6 — CID 122518440
2-[2-[2-[2-[carboxymethyl(ethyl)amino]ethyl-[2-oxo-2-(propylamino)ethyl]amino]ethyl-(2-oxoethyl)amino]ethylamino]acetic acid (PubChem CID 122518440) has the molecular formula C19H37N5O6 and a molecular weight of 431.53 g/mol. Its IUPAC name is 2-[2-[2-[2-[carboxymethyl(ethyl)amino]ethyl-[2-oxo-2-(propylamino)ethyl]amino]ethyl-(2-oxoethyl)amino]ethylamino]acetic acid.
| Compound Name | 2-[2-[2-[2-[carboxymethyl(ethyl)amino]ethyl-[2-oxo-2-(propylamino)ethyl]amino]ethyl-(2-oxoethyl)amino]ethylamino]acetic acid |
|---|---|
| PubChem CID | 122518440 |
| Molecular Formula | C19H37N5O6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | 2-[2-[2-[2-[carboxymethyl(ethyl)amino]ethyl-[2-oxo-2-(propylamino)ethyl]amino]ethyl-(2-oxoethyl)amino]ethylamino]acetic acid |
| SMILES | CCCNC(=O)CN(CCN(CC=O)CCNCC(=O)O)CCN(CC)CC(=O)O |
| InChI | InChI=1S/C19H37N5O6/c1-3-5-21-17(26)15-24(10-8-22(4-2)16-19(29)30)11-9-23(12-13-25)7-6-20-14-18(27)28/h13,20H,3-12,14-16H2,1-2H3,(H,21,26)(H,27,28)(H,29,30) |
| InChIKey | QCEIECVLYOWHGB-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|