C16H29N3O9 — CID 164569892
2-[2-[2-[bis(carboxymethyl)amino]ethyl-(2-oxoethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethane (PubChem CID 164569892) has the molecular formula C16H29N3O9 and a molecular weight of 407.42 g/mol. Its IUPAC name is 2-[2-[2-[bis(carboxymethyl)amino]ethyl-(2-oxoethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethane.
| Compound Name | 2-[2-[2-[bis(carboxymethyl)amino]ethyl-(2-oxoethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethane |
|---|---|
| PubChem CID | 164569892 |
| Molecular Formula | C16H29N3O9 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 2-[2-[2-[bis(carboxymethyl)amino]ethyl-(2-oxoethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethane |
| SMILES | CC.O=CCN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C14H23N3O9.C2H6/c18-6-5-15(1-3-16(7-11(19)20)8-12(21)22)2-4-17(9-13(23)24)10-14(25)26;1-2/h6H,1-5,7-10H2,(H,19,20)(H,21,22)(H,23,24)(H,25,26);1-2H3 |
| InChIKey | RLRVXGSQUGLOCA-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 175.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|