C18H29N3O9 — CID 166074882
2-[2-[[(1S,2S)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]ethyl-(2-oxoethyl)amino]acetic acid (PubChem CID 166074882) has the molecular formula C18H29N3O9 and a molecular weight of 431.44 g/mol. Its IUPAC name is 2-[2-[[(1S,2S)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]ethyl-(2-oxoethyl)amino]acetic acid.
| Compound Name | 2-[2-[[(1S,2S)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]ethyl-(2-oxoethyl)amino]acetic acid |
|---|---|
| PubChem CID | 166074882 |
| Molecular Formula | C18H29N3O9 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 2-[2-[[(1S,2S)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]ethyl-(2-oxoethyl)amino]acetic acid |
| SMILES | O=CCN(CCN(CC(=O)O)[C@H]1CCCC[C@@H]1N(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C18H29N3O9/c22-8-7-19(9-15(23)24)5-6-20(10-16(25)26)13-3-1-2-4-14(13)21(11-17(27)28)12-18(29)30/h8,13-14H,1-7,9-12H2,(H,23,24)(H,25,26)(H,27,28)(H,29,30)/t13-,14-/m0/s1 |
| InChIKey | NPNUYQAPUPZNJZ-KBPBESRZSA-N |
| XLogP | -1.26 |
| TPSA | 175.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|