C12H22N2O8 — CID 23594176
2-[[2-[bis(hydroperoxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid (PubChem CID 23594176) has the molecular formula C12H22N2O8 and a molecular weight of 322.31 g/mol. Its IUPAC name is 2-[[2-[bis(hydroperoxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[2-[bis(hydroperoxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 23594176 |
| Molecular Formula | C12H22N2O8 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-[[2-[bis(hydroperoxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)C1CCCCC1N(COO)COO |
| InChI | InChI=1S/C12H22N2O8/c15-11(16)5-13(6-12(17)18)9-3-1-2-4-10(9)14(7-21-19)8-22-20/h9-10,19-20H,1-8H2,(H,15,16)(H,17,18) |
| InChIKey | WSSWTAMQRANEMV-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|