C32H54N4O12 — CID 158670083
2-[[(1S,2S)-2-[bis(carboxymethyl)amino]cyclohexyl]-[2-[[[(1R,2R)-2-[bis(formyloxymethyl)amino]cyclohexyl]-(formyloxymethyl)amino]methyl]heptyl]amino]acetic acid (PubChem CID 158670083) has the molecular formula C32H54N4O12 and a molecular weight of 686.80 g/mol. Its IUPAC name is 2-[[(1S,2S)-2-[bis(carboxymethyl)amino]cyclohexyl]-[2-[[[(1R,2R)-2-[bis(formyloxymethyl)amino]cyclohexyl]-(formyloxymethyl)amino]methyl]heptyl]amino]acetic acid.
| Compound Name | 2-[[(1S,2S)-2-[bis(carboxymethyl)amino]cyclohexyl]-[2-[[[(1R,2R)-2-[bis(formyloxymethyl)amino]cyclohexyl]-(formyloxymethyl)amino]methyl]heptyl]amino]acetic acid |
|---|---|
| PubChem CID | 158670083 |
| Molecular Formula | C32H54N4O12 |
| Molecular Weight | 686.80 g/mol |
| Exact Mass | 686.37 |
| IUPAC Name | 2-[[(1S,2S)-2-[bis(carboxymethyl)amino]cyclohexyl]-[2-[[[(1R,2R)-2-[bis(formyloxymethyl)amino]cyclohexyl]-(formyloxymethyl)amino]methyl]heptyl]amino]acetic acid |
| SMILES | CCCCCC(CN(COC=O)[C@@H]1CCCC[C@H]1N(COC=O)COC=O)CN(CC(=O)O)[C@H]1CCCC[C@@H]1N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C32H54N4O12/c1-2-3-4-9-25(14-33(16-30(40)41)26-10-5-6-11-27(26)34(17-31(42)43)18-32(44)45)15-35(19-46-22-37)28-12-7-8-13-29(28)36(20-47-23-38)21-48-24-39/h22-29H,2-21H2,1H3,(H,40,41)(H,42,43)(H,44,45)/t25?,26-,27-,28+,29+/m0/s1 |
| InChIKey | BGCXYIARUSDRBG-FAJFXTHDSA-N |
| XLogP | 1.66 |
| TPSA | 203.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.80 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|