C20H36N2O3 — CID 156726710
2-[[2-[2-methylprop-2-enyl(2-oxopropyl)amino]cyclohexyl]-pentylamino]acetic acid (PubChem CID 156726710) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is 2-[[2-[2-methylprop-2-enyl(2-oxopropyl)amino]cyclohexyl]-pentylamino]acetic acid.
| Compound Name | 2-[[2-[2-methylprop-2-enyl(2-oxopropyl)amino]cyclohexyl]-pentylamino]acetic acid |
|---|---|
| PubChem CID | 156726710 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | 2-[[2-[2-methylprop-2-enyl(2-oxopropyl)amino]cyclohexyl]-pentylamino]acetic acid |
| SMILES | C=C(C)CN(CC(C)=O)C1CCCCC1N(CCCCC)CC(=O)O |
| InChI | InChI=1S/C20H36N2O3/c1-5-6-9-12-21(15-20(24)25)18-10-7-8-11-19(18)22(13-16(2)3)14-17(4)23/h18-19H,2,5-15H2,1,3-4H3,(H,24,25) |
| InChIKey | JNTAQOMHBQFRQB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|