C13H23NO5 — CID 118026795
2-[[(1S,2S)-2-butoxycyclopentyl]-(carboxymethyl)amino]acetic acid (PubChem CID 118026795) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[[(1S,2S)-2-butoxycyclopentyl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[(1S,2S)-2-butoxycyclopentyl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 118026795 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-[[(1S,2S)-2-butoxycyclopentyl]-(carboxymethyl)amino]acetic acid |
| SMILES | CCCCO[C@H]1CCC[C@@H]1N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C13H23NO5/c1-2-3-7-19-11-6-4-5-10(11)14(8-12(15)16)9-13(17)18/h10-11H,2-9H2,1H3,(H,15,16)(H,17,18)/t10-,11-/m0/s1 |
| InChIKey | VMVNMEOPSJYMDI-QWRGUYRKSA-N |
| XLogP | 1.20 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|