About 2-[cyclohexyl(formyloxymethyl)amino]acetic acid;methane;propane
2-[cyclohexyl(formyloxymethyl)amino]acetic acid;methane;propane (PubChem CID 158576303) has the molecular formula C14H29NO4
and a molecular weight of 275.39 g/mol. Its IUPAC name is 2-[cyclohexyl(formyloxymethyl)amino]acetic acid;methane;propane.
Molecular Properties
| Compound Name | 2-[cyclohexyl(formyloxymethyl)amino]acetic acid;methane;propane |
| PubChem CID | 158576303 |
| Molecular Formula | C14H29NO4 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 2-[cyclohexyl(formyloxymethyl)amino]acetic acid;methane;propane |
| SMILES | C.CCC.O=COCN(CC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C10H17NO4.C3H8.CH4/c12-8-15-7-11(6-10(13)14)9-4-2-1-3-5-9;1-3-2;/h8-9H,1-7H2,(H,13,14);3H2,1-2H3;1H4 |
| InChIKey | HSRUKYJATGLPLP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[cyclohexyl(formyloxymethyl)amino]acetic acid;methane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclohexyl(formyloxymethyl)amino]acetic acid;methane;propane?
The IUPAC name of 2-[cyclohexyl(formyloxymethyl)amino]acetic acid;methane;propane (CID 158576303) is 2-[cyclohexyl(formyloxymethyl)amino]acetic acid;methane;propane.
What is the SMILES notation for 2-[cyclohexyl(formyloxymethyl)amino]acetic acid;methane;propane?
The canonical SMILES for 2-[cyclohexyl(formyloxymethyl)amino]acetic acid;methane;propane is C.CCC.O=COCN(CC(=O)O)C1CCCCC1.
What is the InChIKey of 2-[cyclohexyl(formyloxymethyl)amino]acetic acid;methane;propane?
The InChIKey is HSRUKYJATGLPLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO4.C3H8.CH4/c12-8-15-7-11(6-10(13)14)9-4-2-1-3-5-9;1-3-2;/h8-9H,1-7H2,(H,13,14);3H2,1-2H3;1H4.
What are the key properties of 2-[cyclohexyl(formyloxymethyl)amino]acetic acid;methane;propane?
2-[cyclohexyl(formyloxymethyl)amino]acetic acid;methane;propane has a molecular weight of 275.39 g/mol, XLogP of 2.89, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclohexyl(formyloxymethyl)amino]acetic acid;methane;propane is sourced from PubChem (CID 158576303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).